C23H30O10 — CID 5477245
methyl (5E)-11-acetyloxy-8-hydroxy-6-(hydroxymethyl)-4-[(E)-2-methylbut-2-enoyl]oxy-3-methylidene-2-oxo-3a,4,7,8,9,10,11,11a-octahydrocyclodeca[b]furan-10-carboxylate (PubChem CID 5477245) has the molecular formula C23H30O10 and a molecular weight of 466.48 g/mol. Its IUPAC name is methyl (5E)-11-acetyloxy-8-hydroxy-6-(hydroxymethyl)-4-[(E)-2-methylbut-2-enoyl]oxy-3-methylidene-2-oxo-3a,4,7,8,9,10,11,11a-octahydrocyclodeca[b]furan-10-carboxylate.
| Compound Name | methyl (5E)-11-acetyloxy-8-hydroxy-6-(hydroxymethyl)-4-[(E)-2-methylbut-2-enoyl]oxy-3-methylidene-2-oxo-3a,4,7,8,9,10,11,11a-octahydrocyclodeca[b]furan-10-carboxylate |
|---|---|
| PubChem CID | 5477245 |
| Molecular Formula | C23H30O10 |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | methyl (5E)-11-acetyloxy-8-hydroxy-6-(hydroxymethyl)-4-[(E)-2-methylbut-2-enoyl]oxy-3-methylidene-2-oxo-3a,4,7,8,9,10,11,11a-octahydrocyclodeca[b]furan-10-carboxylate |
| SMILES | C=C1C(=O)OC2C(OC(C)=O)C(C(=O)OC)CC(O)C/C(CO)=C\C(OC(=O)/C(C)=C/C)C12 |
| InChI | InChI=1S/C23H30O10/c1-6-11(2)21(27)32-17-8-14(10-24)7-15(26)9-16(23(29)30-5)19(31-13(4)25)20-18(17)12(3)22(28)33-20/h6,8,15-20,24,26H,3,7,9-10H2,1-2,4-5H3/b11-6+,14-8+ |
| InChIKey | QUKACLSVALWXMZ-AQPDGSPGSA-N |
| XLogP | 0.76 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|