About CID 5477260
CID 5477260 (PubChem CID 5477260) has the molecular formula C6H4Cl2N2
and a molecular weight of 175.02 g/mol.
Molecular Properties
| Compound Name | CID 5477260 |
| PubChem CID | 5477260 |
| Molecular Formula | C6H4Cl2N2 |
| Molecular Weight | 175.02 g/mol |
| Exact Mass | 173.98 |
| IUPAC Name | — |
| SMILES | [NH]c1cc(Cl)c(Cl)cc1[NH] |
| InChI | InChI=1S/C6H4Cl2N2/c7-3-1-5(9)6(10)2-4(3)8/h1-2,9-10H |
| InChIKey | XGCJVYYMGMELEB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 47.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.02 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 5477260 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 5477260?
The IUPAC name of CID 5477260 (CID 5477260) is not available.
What is the SMILES notation for CID 5477260?
The canonical SMILES for CID 5477260 is [NH]c1cc(Cl)c(Cl)cc1[NH].
What is the InChIKey of CID 5477260?
The InChIKey is XGCJVYYMGMELEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2N2/c7-3-1-5(9)6(10)2-4(3)8/h1-2,9-10H.
What are the key properties of CID 5477260?
CID 5477260 has a molecular weight of 175.02 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 5477260 is sourced from PubChem (CID 5477260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).