C17H23N3O2 — CID 54773621
3-piperazin-1-yl-1-(2-propan-2-ylphenyl)pyrrolidine-2,5-dione (PubChem CID 54773621) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-piperazin-1-yl-1-(2-propan-2-ylphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-piperazin-1-yl-1-(2-propan-2-ylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 54773621 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 3-piperazin-1-yl-1-(2-propan-2-ylphenyl)pyrrolidine-2,5-dione |
| SMILES | CC(C)c1ccccc1N1C(=O)CC(N2CCNCC2)C1=O |
| InChI | InChI=1S/C17H23N3O2/c1-12(2)13-5-3-4-6-14(13)20-16(21)11-15(17(20)22)19-9-7-18-8-10-19/h3-6,12,15,18H,7-11H2,1-2H3 |
| InChIKey | GFRXKGIWIBWJRU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|