About 9-methyl-1,4-diazaspiro[5.5]undecan-5-one
9-methyl-1,4-diazaspiro[5.5]undecan-5-one (PubChem CID 54773629) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is 9-methyl-1,4-diazaspiro[5.5]undecan-5-one.
Molecular Properties
| Compound Name | 9-methyl-1,4-diazaspiro[5.5]undecan-5-one |
| PubChem CID | 54773629 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 9-methyl-1,4-diazaspiro[5.5]undecan-5-one |
| SMILES | CC1CCC2(CC1)NCCNC2=O |
| InChI | InChI=1S/C10H18N2O/c1-8-2-4-10(5-3-8)9(13)11-6-7-12-10/h8,12H,2-7H2,1H3,(H,11,13) |
| InChIKey | UDIBOOPQUUMQJX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-methyl-1,4-diazaspiro[5.5]undecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-1,4-diazaspiro[5.5]undecan-5-one?
The IUPAC name of 9-methyl-1,4-diazaspiro[5.5]undecan-5-one (CID 54773629) is 9-methyl-1,4-diazaspiro[5.5]undecan-5-one.
What is the SMILES notation for 9-methyl-1,4-diazaspiro[5.5]undecan-5-one?
The canonical SMILES for 9-methyl-1,4-diazaspiro[5.5]undecan-5-one is CC1CCC2(CC1)NCCNC2=O.
What is the InChIKey of 9-methyl-1,4-diazaspiro[5.5]undecan-5-one?
The InChIKey is UDIBOOPQUUMQJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O/c1-8-2-4-10(5-3-8)9(13)11-6-7-12-10/h8,12H,2-7H2,1H3,(H,11,13).
What are the key properties of 9-methyl-1,4-diazaspiro[5.5]undecan-5-one?
9-methyl-1,4-diazaspiro[5.5]undecan-5-one has a molecular weight of 182.27 g/mol, XLogP of 0.65, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-1,4-diazaspiro[5.5]undecan-5-one is sourced from PubChem (CID 54773629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).