C18H20CuN2O2 — CID 5477367
copper;(6Z)-6-[1-[2-[[(1Z)-1-(6-oxocyclohexa-2,4-dien-1-ylidene)ethyl]amino]ethylamino]ethylidene]cyclohexa-2,4-dien-1-one (PubChem CID 5477367) has the molecular formula C18H20CuN2O2 and a molecular weight of 359.92 g/mol. Its IUPAC name is copper;(6Z)-6-[1-[2-[[(1Z)-1-(6-oxocyclohexa-2,4-dien-1-ylidene)ethyl]amino]ethylamino]ethylidene]cyclohexa-2,4-dien-1-one.
| Compound Name | copper;(6Z)-6-[1-[2-[[(1Z)-1-(6-oxocyclohexa-2,4-dien-1-ylidene)ethyl]amino]ethylamino]ethylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 5477367 |
| Molecular Formula | C18H20CuN2O2 |
| Molecular Weight | 359.92 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | copper;(6Z)-6-[1-[2-[[(1Z)-1-(6-oxocyclohexa-2,4-dien-1-ylidene)ethyl]amino]ethylamino]ethylidene]cyclohexa-2,4-dien-1-one |
| SMILES | C/C(NCCN/C(C)=C1/C=CC=CC1=O)=C1\C=CC=CC1=O.[Cu] |
| InChI | InChI=1S/C18H20N2O2.Cu/c1-13(15-7-3-5-9-17(15)21)19-11-12-20-14(2)16-8-4-6-10-18(16)22;/h3-10,19-20H,11-12H2,1-2H3;/b15-13-,16-14-; |
| InChIKey | ZXLDYJLIVLQWLP-MWEBDPMNSA-N |
| XLogP | 2.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.92 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|