About 3-nitro-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzamide
3-nitro-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzamide (PubChem CID 54773738) has the molecular formula C18H15N3O3S
and a molecular weight of 353.40 g/mol. Its IUPAC name is 3-nitro-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzamide.
Molecular Properties
| Compound Name | 3-nitro-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzamide |
| PubChem CID | 54773738 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 3-nitro-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1nc(-c2ccccc2)cs1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15N3O3S/c22-18(14-7-4-8-15(11-14)21(23)24)19-10-9-17-20-16(12-25-17)13-5-2-1-3-6-13/h1-8,11-12H,9-10H2,(H,19,22) |
| InChIKey | LIYVWMXUZLFTEM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzamide?
The IUPAC name of 3-nitro-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzamide (CID 54773738) is 3-nitro-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzamide.
What is the SMILES notation for 3-nitro-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzamide?
The canonical SMILES for 3-nitro-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzamide is O=C(NCCc1nc(-c2ccccc2)cs1)c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 3-nitro-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzamide?
The InChIKey is LIYVWMXUZLFTEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O3S/c22-18(14-7-4-8-15(11-14)21(23)24)19-10-9-17-20-16(12-25-17)13-5-2-1-3-6-13/h1-8,11-12H,9-10H2,(H,19,22).
What are the key properties of 3-nitro-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzamide?
3-nitro-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzamide has a molecular weight of 353.40 g/mol, XLogP of 3.69, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzamide is sourced from PubChem (CID 54773738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).