C29H40O10 — CID 5477432
(19E,21E)-13-hydroxy-18-(1-hydroxyethyl)-6,14,26-trimethylspiro[2,5,11,17,24-pentaoxapentacyclo[23.2.1.03,9.04,6.09,26]octacosa-19,21-diene-27,2'-oxirane]-12,23-dione (PubChem CID 5477432) has the molecular formula C29H40O10 and a molecular weight of 548.63 g/mol. Its IUPAC name is (19E,21E)-13-hydroxy-18-(1-hydroxyethyl)-6,14,26-trimethylspiro[2,5,11,17,24-pentaoxapentacyclo[23.2.1.03,9.04,6.09,26]octacosa-19,21-diene-27,2'-oxirane]-12,23-dione.
| Compound Name | (19E,21E)-13-hydroxy-18-(1-hydroxyethyl)-6,14,26-trimethylspiro[2,5,11,17,24-pentaoxapentacyclo[23.2.1.03,9.04,6.09,26]octacosa-19,21-diene-27,2'-oxirane]-12,23-dione |
|---|---|
| PubChem CID | 5477432 |
| Molecular Formula | C29H40O10 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | (19E,21E)-13-hydroxy-18-(1-hydroxyethyl)-6,14,26-trimethylspiro[2,5,11,17,24-pentaoxapentacyclo[23.2.1.03,9.04,6.09,26]octacosa-19,21-diene-27,2'-oxirane]-12,23-dione |
| SMILES | CC(O)C1/C=C/C=C/C(=O)OC2CC3OC4C5OC5(C)CCC4(COC(=O)C(O)C(C)CCO1)C2(C)C31CO1 |
| InChI | InChI=1S/C29H40O10/c1-16-9-12-34-18(17(2)30)7-5-6-8-21(31)37-19-13-20-29(15-36-29)27(19,4)28(14-35-25(33)22(16)32)11-10-26(3)23(39-26)24(28)38-20/h5-8,16-20,22-24,30,32H,9-15H2,1-4H3/b7-5+,8-6- |
| InChIKey | POIJHYBEYXGIET-YMBWGVAGSA-N |
| XLogP | 1.60 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|