C22H25BrN2O3 — CID 54775195
3-(4-bromophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N,N-diethylpropanamide (PubChem CID 54775195) has the molecular formula C22H25BrN2O3 and a molecular weight of 445.36 g/mol. Its IUPAC name is 3-(4-bromophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N,N-diethylpropanamide.
| Compound Name | 3-(4-bromophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 54775195 |
| Molecular Formula | C22H25BrN2O3 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 3-(4-bromophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CC(c1ccc(Br)cc1)N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C22H25BrN2O3/c1-3-24(4-2)18(26)12-17(13-7-9-16(23)10-8-13)25-21(27)19-14-5-6-15(11-14)20(19)22(25)28/h5-10,14-15,17,19-20H,3-4,11-12H2,1-2H3 |
| InChIKey | SBLQVDWZAJWSCE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|