About 4-fluoro-N-methyl-2,3-dihydro-1H-inden-1-amine
4-fluoro-N-methyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 54775831) has the molecular formula C10H12FN
and a molecular weight of 165.21 g/mol. Its IUPAC name is 4-fluoro-N-methyl-2,3-dihydro-1H-inden-1-amine.
Molecular Properties
| Compound Name | 4-fluoro-N-methyl-2,3-dihydro-1H-inden-1-amine |
| PubChem CID | 54775831 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 4-fluoro-N-methyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CNC1CCc2c(F)cccc21 |
| InChI | InChI=1S/C10H12FN/c1-12-10-6-5-7-8(10)3-2-4-9(7)11/h2-4,10,12H,5-6H2,1H3 |
| InChIKey | IUOQQOTZXJNEJR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-N-methyl-2,3-dihydro-1H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-methyl-2,3-dihydro-1H-inden-1-amine?
The IUPAC name of 4-fluoro-N-methyl-2,3-dihydro-1H-inden-1-amine (CID 54775831) is 4-fluoro-N-methyl-2,3-dihydro-1H-inden-1-amine.
What is the SMILES notation for 4-fluoro-N-methyl-2,3-dihydro-1H-inden-1-amine?
The canonical SMILES for 4-fluoro-N-methyl-2,3-dihydro-1H-inden-1-amine is CNC1CCc2c(F)cccc21.
What is the InChIKey of 4-fluoro-N-methyl-2,3-dihydro-1H-inden-1-amine?
The InChIKey is IUOQQOTZXJNEJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FN/c1-12-10-6-5-7-8(10)3-2-4-9(7)11/h2-4,10,12H,5-6H2,1H3.
What are the key properties of 4-fluoro-N-methyl-2,3-dihydro-1H-inden-1-amine?
4-fluoro-N-methyl-2,3-dihydro-1H-inden-1-amine has a molecular weight of 165.21 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-methyl-2,3-dihydro-1H-inden-1-amine is sourced from PubChem (CID 54775831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).