About 6-chloro-N-methyl-2,3-dihydro-1H-inden-1-amine
6-chloro-N-methyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 54776023) has the molecular formula C10H12ClN
and a molecular weight of 181.67 g/mol. Its IUPAC name is 6-chloro-N-methyl-2,3-dihydro-1H-inden-1-amine.
Molecular Properties
| Compound Name | 6-chloro-N-methyl-2,3-dihydro-1H-inden-1-amine |
| PubChem CID | 54776023 |
| Molecular Formula | C10H12ClN |
| Molecular Weight | 181.67 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 6-chloro-N-methyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CNC1CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C10H12ClN/c1-12-10-5-3-7-2-4-8(11)6-9(7)10/h2,4,6,10,12H,3,5H2,1H3 |
| InChIKey | MDCGEWCRGNLLKV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.67 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-chloro-N-methyl-2,3-dihydro-1H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-methyl-2,3-dihydro-1H-inden-1-amine?
The IUPAC name of 6-chloro-N-methyl-2,3-dihydro-1H-inden-1-amine (CID 54776023) is 6-chloro-N-methyl-2,3-dihydro-1H-inden-1-amine.
What is the SMILES notation for 6-chloro-N-methyl-2,3-dihydro-1H-inden-1-amine?
The canonical SMILES for 6-chloro-N-methyl-2,3-dihydro-1H-inden-1-amine is CNC1CCc2ccc(Cl)cc21.
What is the InChIKey of 6-chloro-N-methyl-2,3-dihydro-1H-inden-1-amine?
The InChIKey is MDCGEWCRGNLLKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN/c1-12-10-5-3-7-2-4-8(11)6-9(7)10/h2,4,6,10,12H,3,5H2,1H3.
What are the key properties of 6-chloro-N-methyl-2,3-dihydro-1H-inden-1-amine?
6-chloro-N-methyl-2,3-dihydro-1H-inden-1-amine has a molecular weight of 181.67 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-methyl-2,3-dihydro-1H-inden-1-amine is sourced from PubChem (CID 54776023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).