About 3-(cyclopropylmethyl)-1,2-oxazol-5-amine
3-(cyclopropylmethyl)-1,2-oxazol-5-amine (PubChem CID 54776320) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | 3-(cyclopropylmethyl)-1,2-oxazol-5-amine |
| PubChem CID | 54776320 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 3-(cyclopropylmethyl)-1,2-oxazol-5-amine |
| SMILES | Nc1cc(CC2CC2)no1 |
| InChI | InChI=1S/C7H10N2O/c8-7-4-6(9-10-7)3-5-1-2-5/h4-5H,1-3,8H2 |
| InChIKey | HRYYRLZQXLBRFY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(cyclopropylmethyl)-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclopropylmethyl)-1,2-oxazol-5-amine?
The IUPAC name of 3-(cyclopropylmethyl)-1,2-oxazol-5-amine (CID 54776320) is 3-(cyclopropylmethyl)-1,2-oxazol-5-amine.
What is the SMILES notation for 3-(cyclopropylmethyl)-1,2-oxazol-5-amine?
The canonical SMILES for 3-(cyclopropylmethyl)-1,2-oxazol-5-amine is Nc1cc(CC2CC2)no1.
What is the InChIKey of 3-(cyclopropylmethyl)-1,2-oxazol-5-amine?
The InChIKey is HRYYRLZQXLBRFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c8-7-4-6(9-10-7)3-5-1-2-5/h4-5H,1-3,8H2.
What are the key properties of 3-(cyclopropylmethyl)-1,2-oxazol-5-amine?
3-(cyclopropylmethyl)-1,2-oxazol-5-amine has a molecular weight of 138.17 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopropylmethyl)-1,2-oxazol-5-amine is sourced from PubChem (CID 54776320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).