C19H22O3 — CID 5477666
(6Z,9Z)-7,11,11,14-tetramethyl-16-oxatricyclo[11.2.1.01,5]hexadeca-4,6,9,13-tetraene-8,15-dione (PubChem CID 5477666) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (6Z,9Z)-7,11,11,14-tetramethyl-16-oxatricyclo[11.2.1.01,5]hexadeca-4,6,9,13-tetraene-8,15-dione.
| Compound Name | (6Z,9Z)-7,11,11,14-tetramethyl-16-oxatricyclo[11.2.1.01,5]hexadeca-4,6,9,13-tetraene-8,15-dione |
|---|---|
| PubChem CID | 5477666 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (6Z,9Z)-7,11,11,14-tetramethyl-16-oxatricyclo[11.2.1.01,5]hexadeca-4,6,9,13-tetraene-8,15-dione |
| SMILES | CC1=C2CC(C)(C)/C=C\C(=O)/C(C)=C\C3=CCCC3(O2)C1=O |
| InChI | InChI=1S/C19H22O3/c1-12-10-14-6-5-8-19(14)17(21)13(2)16(22-19)11-18(3,4)9-7-15(12)20/h6-7,9-10H,5,8,11H2,1-4H3/b9-7-,12-10- |
| InChIKey | HNYAMVPKAUHRLY-GEHMVYPESA-N |
| XLogP | 3.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |