About 2-propan-2-yl-3-propyl-1,2-dihydroquinazolin-4-one
2-propan-2-yl-3-propyl-1,2-dihydroquinazolin-4-one (PubChem CID 54778208) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-propan-2-yl-3-propyl-1,2-dihydroquinazolin-4-one.
Molecular Properties
| Compound Name | 2-propan-2-yl-3-propyl-1,2-dihydroquinazolin-4-one |
| PubChem CID | 54778208 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2-propan-2-yl-3-propyl-1,2-dihydroquinazolin-4-one |
| SMILES | CCCN1C(=O)c2ccccc2NC1C(C)C |
| InChI | InChI=1S/C14H20N2O/c1-4-9-16-13(10(2)3)15-12-8-6-5-7-11(12)14(16)17/h5-8,10,13,15H,4,9H2,1-3H3 |
| InChIKey | NPALUXXBYFRYGS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-yl-3-propyl-1,2-dihydroquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-3-propyl-1,2-dihydroquinazolin-4-one?
The IUPAC name of 2-propan-2-yl-3-propyl-1,2-dihydroquinazolin-4-one (CID 54778208) is 2-propan-2-yl-3-propyl-1,2-dihydroquinazolin-4-one.
What is the SMILES notation for 2-propan-2-yl-3-propyl-1,2-dihydroquinazolin-4-one?
The canonical SMILES for 2-propan-2-yl-3-propyl-1,2-dihydroquinazolin-4-one is CCCN1C(=O)c2ccccc2NC1C(C)C.
What is the InChIKey of 2-propan-2-yl-3-propyl-1,2-dihydroquinazolin-4-one?
The InChIKey is NPALUXXBYFRYGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O/c1-4-9-16-13(10(2)3)15-12-8-6-5-7-11(12)14(16)17/h5-8,10,13,15H,4,9H2,1-3H3.
What are the key properties of 2-propan-2-yl-3-propyl-1,2-dihydroquinazolin-4-one?
2-propan-2-yl-3-propyl-1,2-dihydroquinazolin-4-one has a molecular weight of 232.33 g/mol, XLogP of 2.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-3-propyl-1,2-dihydroquinazolin-4-one is sourced from PubChem (CID 54778208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).