About [(2E)-3,7-dimethylocta-2,6-dienyl] thiocyanate
[(2E)-3,7-dimethylocta-2,6-dienyl] thiocyanate (PubChem CID 5477824) has the molecular formula C11H17NS
and a molecular weight of 195.33 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] thiocyanate.
Molecular Properties
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] thiocyanate |
| PubChem CID | 5477824 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] thiocyanate |
| SMILES | CC(C)=CCC/C(C)=C/CSC#N |
| InChI | InChI=1S/C11H17NS/c1-10(2)5-4-6-11(3)7-8-13-9-12/h5,7H,4,6,8H2,1-3H3/b11-7+ |
| InChIKey | WFCGOANCWUILIC-YRNVUSSQSA-N |
| XLogP | 3.89 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-3,7-dimethylocta-2,6-dienyl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-3,7-dimethylocta-2,6-dienyl] thiocyanate?
The IUPAC name of [(2E)-3,7-dimethylocta-2,6-dienyl] thiocyanate (CID 5477824) is [(2E)-3,7-dimethylocta-2,6-dienyl] thiocyanate.
What is the SMILES notation for [(2E)-3,7-dimethylocta-2,6-dienyl] thiocyanate?
The canonical SMILES for [(2E)-3,7-dimethylocta-2,6-dienyl] thiocyanate is CC(C)=CCC/C(C)=C/CSC#N.
What is the InChIKey of [(2E)-3,7-dimethylocta-2,6-dienyl] thiocyanate?
The InChIKey is WFCGOANCWUILIC-YRNVUSSQSA-N. The full InChI is InChI=1S/C11H17NS/c1-10(2)5-4-6-11(3)7-8-13-9-12/h5,7H,4,6,8H2,1-3H3/b11-7+.
What are the key properties of [(2E)-3,7-dimethylocta-2,6-dienyl] thiocyanate?
[(2E)-3,7-dimethylocta-2,6-dienyl] thiocyanate has a molecular weight of 195.33 g/mol, XLogP of 3.89, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-3,7-dimethylocta-2,6-dienyl] thiocyanate is sourced from PubChem (CID 5477824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).