C22H28N2O4 — CID 54778625
2-[3-(2-ethoxyethoxy)phenyl]-3-(3-methoxypropyl)-1,2-dihydroquinazolin-4-one (PubChem CID 54778625) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[3-(2-ethoxyethoxy)phenyl]-3-(3-methoxypropyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | 2-[3-(2-ethoxyethoxy)phenyl]-3-(3-methoxypropyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 54778625 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-[3-(2-ethoxyethoxy)phenyl]-3-(3-methoxypropyl)-1,2-dihydroquinazolin-4-one |
| SMILES | CCOCCOc1cccc(C2Nc3ccccc3C(=O)N2CCCOC)c1 |
| InChI | InChI=1S/C22H28N2O4/c1-3-27-14-15-28-18-9-6-8-17(16-18)21-23-20-11-5-4-10-19(20)22(25)24(21)12-7-13-26-2/h4-6,8-11,16,21,23H,3,7,12-15H2,1-2H3 |
| InChIKey | WHYHYDHHYCOJIP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|