About 1-amino-9,10-dioxo-4-[3-[(E)-2-sulfoethenyl]sulfonylanilino]anthracene-2-sulfonic acid
1-amino-9,10-dioxo-4-[3-[(E)-2-sulfoethenyl]sulfonylanilino]anthracene-2-sulfonic acid (PubChem CID 5477876) has the molecular formula C22H16N2O10S3
and a molecular weight of 564.58 g/mol. Its IUPAC name is 1-amino-9,10-dioxo-4-[3-[(E)-2-sulfoethenyl]sulfonylanilino]anthracene-2-sulfonic acid.
Molecular Properties
| Compound Name | 1-amino-9,10-dioxo-4-[3-[(E)-2-sulfoethenyl]sulfonylanilino]anthracene-2-sulfonic acid |
| PubChem CID | 5477876 |
| Molecular Formula | C22H16N2O10S3 |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 564.00 |
| IUPAC Name | 1-amino-9,10-dioxo-4-[3-[(E)-2-sulfoethenyl]sulfonylanilino]anthracene-2-sulfonic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc(Nc2cccc(S(=O)(=O)/C=C/S(=O)(=O)O)c2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H16N2O10S3/c23-20-17(37(32,33)34)11-16(18-19(20)22(26)15-7-2-1-6-14(15)21(18)25)24-12-4-3-5-13(10-12)35(27,28)8-9-36(29,30)31/h1-11,24H,23H2,(H,29,30,31)(H,32,33,34)/b9-8+ |
| InChIKey | MFAKEALTBQSBRB-CMDGGOBGSA-N |
| XLogP | 2.17 |
| TPSA | 215.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-9,10-dioxo-4-[3-[(E)-2-sulfoethenyl]sulfonylanilino]anthracene-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-9,10-dioxo-4-[3-[(E)-2-sulfoethenyl]sulfonylanilino]anthracene-2-sulfonic acid?
The IUPAC name of 1-amino-9,10-dioxo-4-[3-[(E)-2-sulfoethenyl]sulfonylanilino]anthracene-2-sulfonic acid (CID 5477876) is 1-amino-9,10-dioxo-4-[3-[(E)-2-sulfoethenyl]sulfonylanilino]anthracene-2-sulfonic acid.
What is the SMILES notation for 1-amino-9,10-dioxo-4-[3-[(E)-2-sulfoethenyl]sulfonylanilino]anthracene-2-sulfonic acid?
The canonical SMILES for 1-amino-9,10-dioxo-4-[3-[(E)-2-sulfoethenyl]sulfonylanilino]anthracene-2-sulfonic acid is Nc1c(S(=O)(=O)O)cc(Nc2cccc(S(=O)(=O)/C=C/S(=O)(=O)O)c2)c2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of 1-amino-9,10-dioxo-4-[3-[(E)-2-sulfoethenyl]sulfonylanilino]anthracene-2-sulfonic acid?
The InChIKey is MFAKEALTBQSBRB-CMDGGOBGSA-N. The full InChI is InChI=1S/C22H16N2O10S3/c23-20-17(37(32,33)34)11-16(18-19(20)22(26)15-7-2-1-6-14(15)21(18)25)24-12-4-3-5-13(10-12)35(27,28)8-9-36(29,30)31/h1-11,24H,23H2,(H,29,30,31)(H,32,33,34)/b9-8+.
What are the key properties of 1-amino-9,10-dioxo-4-[3-[(E)-2-sulfoethenyl]sulfonylanilino]anthracene-2-sulfonic acid?
1-amino-9,10-dioxo-4-[3-[(E)-2-sulfoethenyl]sulfonylanilino]anthracene-2-sulfonic acid has a molecular weight of 564.58 g/mol, XLogP of 2.17, 6 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-9,10-dioxo-4-[3-[(E)-2-sulfoethenyl]sulfonylanilino]anthracene-2-sulfonic acid is sourced from PubChem (CID 5477876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).