C20H24N2O2 — CID 54779593
2-methyl-2-(3-pentoxyphenyl)-1,3-dihydroquinazolin-4-one (PubChem CID 54779593) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-methyl-2-(3-pentoxyphenyl)-1,3-dihydroquinazolin-4-one.
| Compound Name | 2-methyl-2-(3-pentoxyphenyl)-1,3-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 54779593 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-methyl-2-(3-pentoxyphenyl)-1,3-dihydroquinazolin-4-one |
| SMILES | CCCCCOc1cccc(C2(C)NC(=O)c3ccccc3N2)c1 |
| InChI | InChI=1S/C20H24N2O2/c1-3-4-7-13-24-16-10-8-9-15(14-16)20(2)21-18-12-6-5-11-17(18)19(23)22-20/h5-6,8-12,14,21H,3-4,7,13H2,1-2H3,(H,22,23) |
| InChIKey | CEVWLHHVTHMYAN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|