About 5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde
5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 547796) has the molecular formula C9H16O5
and a molecular weight of 204.22 g/mol. Its IUPAC name is 5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
Molecular Properties
| Compound Name | 5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| PubChem CID | 547796 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | COCC(O)C1OC(C)(C)OC1C=O |
| InChI | InChI=1S/C9H16O5/c1-9(2)13-7(4-10)8(14-9)6(11)5-12-3/h4,6-8,11H,5H2,1-3H3 |
| InChIKey | CPKLRMHTCNBULE-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde?
The IUPAC name of 5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (CID 547796) is 5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
What is the SMILES notation for 5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde?
The canonical SMILES for 5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde is COCC(O)C1OC(C)(C)OC1C=O.
What is the InChIKey of 5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde?
The InChIKey is CPKLRMHTCNBULE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O5/c1-9(2)13-7(4-10)8(14-9)6(11)5-12-3/h4,6-8,11H,5H2,1-3H3.
What are the key properties of 5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde?
5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde has a molecular weight of 204.22 g/mol, XLogP of -0.29, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde is sourced from PubChem (CID 547796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).