C24H30N2O2 — CID 54779617
2-(4-hexoxyphenyl)-2-methyl-3-prop-2-enyl-1H-quinazolin-4-one (PubChem CID 54779617) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-(4-hexoxyphenyl)-2-methyl-3-prop-2-enyl-1H-quinazolin-4-one.
| Compound Name | 2-(4-hexoxyphenyl)-2-methyl-3-prop-2-enyl-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 54779617 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2-(4-hexoxyphenyl)-2-methyl-3-prop-2-enyl-1H-quinazolin-4-one |
| SMILES | C=CCN1C(=O)c2ccccc2NC1(C)c1ccc(OCCCCCC)cc1 |
| InChI | InChI=1S/C24H30N2O2/c1-4-6-7-10-18-28-20-15-13-19(14-16-20)24(3)25-22-12-9-8-11-21(22)23(27)26(24)17-5-2/h5,8-9,11-16,25H,2,4,6-7,10,17-18H2,1,3H3 |
| InChIKey | ODXUJJYEUKYOJM-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|