About 2-ethyl-6-methylpiperidine;2-methyl-6-[(E)-undec-2-enyl]piperidine
2-ethyl-6-methylpiperidine;2-methyl-6-[(E)-undec-2-enyl]piperidine (PubChem CID 5478029) has the molecular formula C25H50N2
and a molecular weight of 378.69 g/mol. Its IUPAC name is 2-ethyl-6-methylpiperidine;2-methyl-6-[(E)-undec-2-enyl]piperidine.
Molecular Properties
| Compound Name | 2-ethyl-6-methylpiperidine;2-methyl-6-[(E)-undec-2-enyl]piperidine |
| PubChem CID | 5478029 |
| Molecular Formula | C25H50N2 |
| Molecular Weight | 378.69 g/mol |
| Exact Mass | 378.40 |
| IUPAC Name | 2-ethyl-6-methylpiperidine;2-methyl-6-[(E)-undec-2-enyl]piperidine |
| SMILES | CCC1CCCC(C)N1.CCCCCCCC/C=C/CC1CCCC(C)N1 |
| InChI | InChI=1S/C17H33N.C8H17N/c1-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16(2)18-17;1-3-8-6-4-5-7(2)9-8/h10-11,16-18H,3-9,12-15H2,1-2H3;7-9H,3-6H2,1-2H3/b11-10+; |
| InChIKey | JZCAMRDTJYUXNN-ASTDGNLGSA-N |
| XLogP | 7.14 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.69 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-6-methylpiperidine;2-methyl-6-[(E)-undec-2-enyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6-methylpiperidine;2-methyl-6-[(E)-undec-2-enyl]piperidine?
The IUPAC name of 2-ethyl-6-methylpiperidine;2-methyl-6-[(E)-undec-2-enyl]piperidine (CID 5478029) is 2-ethyl-6-methylpiperidine;2-methyl-6-[(E)-undec-2-enyl]piperidine.
What is the SMILES notation for 2-ethyl-6-methylpiperidine;2-methyl-6-[(E)-undec-2-enyl]piperidine?
The canonical SMILES for 2-ethyl-6-methylpiperidine;2-methyl-6-[(E)-undec-2-enyl]piperidine is CCC1CCCC(C)N1.CCCCCCCC/C=C/CC1CCCC(C)N1.
What is the InChIKey of 2-ethyl-6-methylpiperidine;2-methyl-6-[(E)-undec-2-enyl]piperidine?
The InChIKey is JZCAMRDTJYUXNN-ASTDGNLGSA-N. The full InChI is InChI=1S/C17H33N.C8H17N/c1-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16(2)18-17;1-3-8-6-4-5-7(2)9-8/h10-11,16-18H,3-9,12-15H2,1-2H3;7-9H,3-6H2,1-2H3/b11-10+;.
What are the key properties of 2-ethyl-6-methylpiperidine;2-methyl-6-[(E)-undec-2-enyl]piperidine?
2-ethyl-6-methylpiperidine;2-methyl-6-[(E)-undec-2-enyl]piperidine has a molecular weight of 378.69 g/mol, XLogP of 7.14, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6-methylpiperidine;2-methyl-6-[(E)-undec-2-enyl]piperidine is sourced from PubChem (CID 5478029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).