C28H32N2O4 — CID 54780419
2-ethyl-3-(3-methoxypropyl)-2-[4-(2-phenoxyethoxy)phenyl]-1H-quinazolin-4-one (PubChem CID 54780419) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is 2-ethyl-3-(3-methoxypropyl)-2-[4-(2-phenoxyethoxy)phenyl]-1H-quinazolin-4-one.
| Compound Name | 2-ethyl-3-(3-methoxypropyl)-2-[4-(2-phenoxyethoxy)phenyl]-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 54780419 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 2-ethyl-3-(3-methoxypropyl)-2-[4-(2-phenoxyethoxy)phenyl]-1H-quinazolin-4-one |
| SMILES | CCC1(c2ccc(OCCOc3ccccc3)cc2)Nc2ccccc2C(=O)N1CCCOC |
| InChI | InChI=1S/C28H32N2O4/c1-3-28(29-26-13-8-7-12-25(26)27(31)30(28)18-9-19-32-2)22-14-16-24(17-15-22)34-21-20-33-23-10-5-4-6-11-23/h4-8,10-17,29H,3,9,18-21H2,1-2H3 |
| InChIKey | VNPYOJJHIZQNDO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|