C34H62O7 — CID 5478065
methyl 2-[5-methyl-6-[(10E,14E)-3,5,7,13-tetrahydroxy-4,6,12,14,16-pentamethylnonadeca-10,14-dien-2-yl]oxan-2-yl]propanoate (PubChem CID 5478065) has the molecular formula C34H62O7 and a molecular weight of 582.86 g/mol. Its IUPAC name is methyl 2-[5-methyl-6-[(10E,14E)-3,5,7,13-tetrahydroxy-4,6,12,14,16-pentamethylnonadeca-10,14-dien-2-yl]oxan-2-yl]propanoate.
| Compound Name | methyl 2-[5-methyl-6-[(10E,14E)-3,5,7,13-tetrahydroxy-4,6,12,14,16-pentamethylnonadeca-10,14-dien-2-yl]oxan-2-yl]propanoate |
|---|---|
| PubChem CID | 5478065 |
| Molecular Formula | C34H62O7 |
| Molecular Weight | 582.86 g/mol |
| Exact Mass | 582.45 |
| IUPAC Name | methyl 2-[5-methyl-6-[(10E,14E)-3,5,7,13-tetrahydroxy-4,6,12,14,16-pentamethylnonadeca-10,14-dien-2-yl]oxan-2-yl]propanoate |
| SMILES | CCCC(C)/C=C(\C)C(O)C(C)/C=C/CCC(O)C(C)C(O)C(C)C(O)C(C)C1OC(C(C)C(=O)OC)CCC1C |
| InChI | InChI=1S/C34H62O7/c1-11-14-20(2)19-23(5)30(36)21(3)15-12-13-16-28(35)24(6)31(37)26(8)32(38)27(9)33-22(4)17-18-29(41-33)25(7)34(39)40-10/h12,15,19-22,24-33,35-38H,11,13-14,16-18H2,1-10H3/b15-12+,23-19+ |
| InChIKey | FVCSFNMNNBRTIS-RPJVLSHYSA-N |
| XLogP | 5.69 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.86 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|