C20H19N5O7S — CID 54782638
N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]-2-(2-nitrophenoxy)propanamide (PubChem CID 54782638) has the molecular formula C20H19N5O7S and a molecular weight of 473.47 g/mol. Its IUPAC name is N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]-2-(2-nitrophenoxy)propanamide.
| Compound Name | N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]-2-(2-nitrophenoxy)propanamide |
|---|---|
| PubChem CID | 54782638 |
| Molecular Formula | C20H19N5O7S |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]-2-(2-nitrophenoxy)propanamide |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(NC(=O)C(C)Oc2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19N5O7S/c1-13(32-17-6-4-3-5-16(17)25(27)28)19(26)23-14-7-9-15(10-8-14)33(29,30)24-18-20(31-2)22-12-11-21-18/h3-13H,1-2H3,(H,21,24)(H,23,26) |
| InChIKey | GDZZECCWZBFGSU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 162.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|