C21H26N2O2 — CID 54784967
N-[(E)-heptan-3-ylideneamino]-4-phenylmethoxybenzamide (PubChem CID 54784967) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-[(E)-heptan-3-ylideneamino]-4-phenylmethoxybenzamide.
| Compound Name | N-[(E)-heptan-3-ylideneamino]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 54784967 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-[(E)-heptan-3-ylideneamino]-4-phenylmethoxybenzamide |
| SMILES | CCCC/C(CC)=N/NC(=O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H26N2O2/c1-3-5-11-19(4-2)22-23-21(24)18-12-14-20(15-13-18)25-16-17-9-7-6-8-10-17/h6-10,12-15H,3-5,11,16H2,1-2H3,(H,23,24)/b22-19+ |
| InChIKey | LXLTVPMBNUUKDU-ZBJSNUHESA-N |
| XLogP | 4.95 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|