C16H14Cl2N2O2S — CID 54785843
N-[(2,6-dichlorophenyl)carbamothioyl]-4-ethoxybenzamide (PubChem CID 54785843) has the molecular formula C16H14Cl2N2O2S and a molecular weight of 369.27 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)carbamothioyl]-4-ethoxybenzamide.
| Compound Name | N-[(2,6-dichlorophenyl)carbamothioyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 54785843 |
| Molecular Formula | C16H14Cl2N2O2S |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | N-[(2,6-dichlorophenyl)carbamothioyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C16H14Cl2N2O2S/c1-2-22-11-8-6-10(7-9-11)15(21)20-16(23)19-14-12(17)4-3-5-13(14)18/h3-9H,2H2,1H3,(H2,19,20,21,23) |
| InChIKey | IYGYYYAXKBZBBK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|