C20H28N2O4 — CID 54786846
propyl 4-[2-(2-cyclooctylidenehydrazinyl)-2-oxoethoxy]benzoate (PubChem CID 54786846) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is propyl 4-[2-(2-cyclooctylidenehydrazinyl)-2-oxoethoxy]benzoate.
| Compound Name | propyl 4-[2-(2-cyclooctylidenehydrazinyl)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 54786846 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | propyl 4-[2-(2-cyclooctylidenehydrazinyl)-2-oxoethoxy]benzoate |
| SMILES | CCCOC(=O)c1ccc(OCC(=O)NN=C2CCCCCCC2)cc1 |
| InChI | InChI=1S/C20H28N2O4/c1-2-14-25-20(24)16-10-12-18(13-11-16)26-15-19(23)22-21-17-8-6-4-3-5-7-9-17/h10-13H,2-9,14-15H2,1H3,(H,22,23) |
| InChIKey | NEALECYTRJGSKS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|