About CID 5478991
CID 5478991 (PubChem CID 5478991) has the molecular formula C4H8NO
and a molecular weight of 86.11 g/mol.
Molecular Properties
| Compound Name | CID 5478991 |
| PubChem CID | 5478991 |
| Molecular Formula | C4H8NO |
| Molecular Weight | 86.11 g/mol |
| Exact Mass | 86.06 |
| IUPAC Name | — |
| SMILES | C=C([O])N(C)C |
| InChI | InChI=1S/C4H8NO/c1-4(6)5(2)3/h1H2,2-3H3 |
| InChIKey | GFMPQVIIOQPJRM-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 23.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.11 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze CID 5478991 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 5478991?
The IUPAC name of CID 5478991 (CID 5478991) is not available.
What is the SMILES notation for CID 5478991?
The canonical SMILES for CID 5478991 is C=C([O])N(C)C.
What is the InChIKey of CID 5478991?
The InChIKey is GFMPQVIIOQPJRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8NO/c1-4(6)5(2)3/h1H2,2-3H3.
What are the key properties of CID 5478991?
CID 5478991 has a molecular weight of 86.11 g/mol, XLogP of 0.45, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 5478991 is sourced from PubChem (CID 5478991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).