C6H7F3O3S — CID 547908
methyl 3,3,3-trifluoro-2-methoxycarbothioylpropanoate (PubChem CID 547908) has the molecular formula C6H7F3O3S and a molecular weight of 216.18 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-methoxycarbothioylpropanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-methoxycarbothioylpropanoate |
|---|---|
| PubChem CID | 547908 |
| Molecular Formula | C6H7F3O3S |
| Molecular Weight | 216.18 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-methoxycarbothioylpropanoate |
| SMILES | COC(=O)C(C(=S)OC)C(F)(F)F |
| InChI | InChI=1S/C6H7F3O3S/c1-11-4(10)3(5(13)12-2)6(7,8)9/h3H,1-2H3 |
| InChIKey | GEEKZZRAZQEBRF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|