About (2S,3S)-3-hydroxy-4,4-dimethyl-2-propylpentanenitrile
(2S,3S)-3-hydroxy-4,4-dimethyl-2-propylpentanenitrile (PubChem CID 5479123) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-4,4-dimethyl-2-propylpentanenitrile.
Molecular Properties
| Compound Name | (2S,3S)-3-hydroxy-4,4-dimethyl-2-propylpentanenitrile |
| PubChem CID | 5479123 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (2S,3S)-3-hydroxy-4,4-dimethyl-2-propylpentanenitrile |
| SMILES | CCC[C@@H](C#N)[C@H](O)C(C)(C)C |
| InChI | InChI=1S/C10H19NO/c1-5-6-8(7-11)9(12)10(2,3)4/h8-9,12H,5-6H2,1-4H3/t8-,9-/m0/s1 |
| InChIKey | IGDQWIURYMZHIC-IUCAKERBSA-N |
| XLogP | 2.33 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,3S)-3-hydroxy-4,4-dimethyl-2-propylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-3-hydroxy-4,4-dimethyl-2-propylpentanenitrile?
The IUPAC name of (2S,3S)-3-hydroxy-4,4-dimethyl-2-propylpentanenitrile (CID 5479123) is (2S,3S)-3-hydroxy-4,4-dimethyl-2-propylpentanenitrile.
What is the SMILES notation for (2S,3S)-3-hydroxy-4,4-dimethyl-2-propylpentanenitrile?
The canonical SMILES for (2S,3S)-3-hydroxy-4,4-dimethyl-2-propylpentanenitrile is CCC[C@@H](C#N)[C@H](O)C(C)(C)C.
What is the InChIKey of (2S,3S)-3-hydroxy-4,4-dimethyl-2-propylpentanenitrile?
The InChIKey is IGDQWIURYMZHIC-IUCAKERBSA-N. The full InChI is InChI=1S/C10H19NO/c1-5-6-8(7-11)9(12)10(2,3)4/h8-9,12H,5-6H2,1-4H3/t8-,9-/m0/s1.
What are the key properties of (2S,3S)-3-hydroxy-4,4-dimethyl-2-propylpentanenitrile?
(2S,3S)-3-hydroxy-4,4-dimethyl-2-propylpentanenitrile has a molecular weight of 169.27 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-hydroxy-4,4-dimethyl-2-propylpentanenitrile is sourced from PubChem (CID 5479123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).