About prop-2-enyl 3-bromo-4-ethoxybenzoate
prop-2-enyl 3-bromo-4-ethoxybenzoate (PubChem CID 54793268) has the molecular formula C12H13BrO3
and a molecular weight of 285.14 g/mol. Its IUPAC name is prop-2-enyl 3-bromo-4-ethoxybenzoate.
Molecular Properties
| Compound Name | prop-2-enyl 3-bromo-4-ethoxybenzoate |
| PubChem CID | 54793268 |
| Molecular Formula | C12H13BrO3 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | prop-2-enyl 3-bromo-4-ethoxybenzoate |
| SMILES | C=CCOC(=O)c1ccc(OCC)c(Br)c1 |
| InChI | InChI=1S/C12H13BrO3/c1-3-7-16-12(14)9-5-6-11(15-4-2)10(13)8-9/h3,5-6,8H,1,4,7H2,2H3 |
| InChIKey | WEUYEXCVNVNKGQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 3-bromo-4-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 3-bromo-4-ethoxybenzoate?
The IUPAC name of prop-2-enyl 3-bromo-4-ethoxybenzoate (CID 54793268) is prop-2-enyl 3-bromo-4-ethoxybenzoate.
What is the SMILES notation for prop-2-enyl 3-bromo-4-ethoxybenzoate?
The canonical SMILES for prop-2-enyl 3-bromo-4-ethoxybenzoate is C=CCOC(=O)c1ccc(OCC)c(Br)c1.
What is the InChIKey of prop-2-enyl 3-bromo-4-ethoxybenzoate?
The InChIKey is WEUYEXCVNVNKGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrO3/c1-3-7-16-12(14)9-5-6-11(15-4-2)10(13)8-9/h3,5-6,8H,1,4,7H2,2H3.
What are the key properties of prop-2-enyl 3-bromo-4-ethoxybenzoate?
prop-2-enyl 3-bromo-4-ethoxybenzoate has a molecular weight of 285.14 g/mol, XLogP of 3.19, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 3-bromo-4-ethoxybenzoate is sourced from PubChem (CID 54793268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).