C18H26BrNO2 — CID 54793485
azepan-1-yl-[3-bromo-4-(3-methylbutoxy)phenyl]methanone (PubChem CID 54793485) has the molecular formula C18H26BrNO2 and a molecular weight of 368.32 g/mol. Its IUPAC name is azepan-1-yl-[3-bromo-4-(3-methylbutoxy)phenyl]methanone.
| Compound Name | azepan-1-yl-[3-bromo-4-(3-methylbutoxy)phenyl]methanone |
|---|---|
| PubChem CID | 54793485 |
| Molecular Formula | C18H26BrNO2 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | azepan-1-yl-[3-bromo-4-(3-methylbutoxy)phenyl]methanone |
| SMILES | CC(C)CCOc1ccc(C(=O)N2CCCCCC2)cc1Br |
| InChI | InChI=1S/C18H26BrNO2/c1-14(2)9-12-22-17-8-7-15(13-16(17)19)18(21)20-10-5-3-4-6-11-20/h7-8,13-14H,3-6,9-12H2,1-2H3 |
| InChIKey | IRUOMSQTEBCJRX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |