C40H46N2O6 — CID 5479375
tert-butyl N-[(2S,3S,5R)-3-hydroxy-6-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-6-oxo-1-phenyl-5-[(4-phenylmethoxyphenyl)methyl]hexan-2-yl]carbamate (PubChem CID 5479375) has the molecular formula C40H46N2O6 and a molecular weight of 650.82 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,5R)-3-hydroxy-6-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-6-oxo-1-phenyl-5-[(4-phenylmethoxyphenyl)methyl]hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,5R)-3-hydroxy-6-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-6-oxo-1-phenyl-5-[(4-phenylmethoxyphenyl)methyl]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 5479375 |
| Molecular Formula | C40H46N2O6 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.34 |
| IUPAC Name | tert-butyl N-[(2S,3S,5R)-3-hydroxy-6-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-6-oxo-1-phenyl-5-[(4-phenylmethoxyphenyl)methyl]hexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)C[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)N[C@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C40H46N2O6/c1-40(2,3)48-39(46)41-34(23-27-12-6-4-7-13-27)35(43)25-31(38(45)42-37-33-17-11-10-16-30(33)24-36(37)44)22-28-18-20-32(21-19-28)47-26-29-14-8-5-9-15-29/h4-21,31,34-37,43-44H,22-26H2,1-3H3,(H,41,46)(H,42,45)/t31-,34+,35+,36-,37+/m1/s1 |
| InChIKey | LRRAWJHFJBTJSY-SZNOJMITSA-N |
| XLogP | 6.09 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |