C17H25N3O4 — CID 54794152
1-(2,4-diethoxybenzoyl)piperidine-4-carbohydrazide (PubChem CID 54794152) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-(2,4-diethoxybenzoyl)piperidine-4-carbohydrazide.
| Compound Name | 1-(2,4-diethoxybenzoyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 54794152 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 1-(2,4-diethoxybenzoyl)piperidine-4-carbohydrazide |
| SMILES | CCOc1ccc(C(=O)N2CCC(C(=O)NN)CC2)c(OCC)c1 |
| InChI | InChI=1S/C17H25N3O4/c1-3-23-13-5-6-14(15(11-13)24-4-2)17(22)20-9-7-12(8-10-20)16(21)19-18/h5-6,11-12H,3-4,7-10,18H2,1-2H3,(H,19,21) |
| InChIKey | OSZUGFUGOPOBJF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|