C14H42O7Si7 — CID 547942
2,4,6,8,10,12,14-heptaethyl-1,3,5,7,9,11,13-heptaoxa-2,4,6,8,10,12,14-heptasilacyclotetradecane (PubChem CID 547942) has the molecular formula C14H42O7Si7 and a molecular weight of 519.09 g/mol. Its IUPAC name is 2,4,6,8,10,12,14-heptaethyl-1,3,5,7,9,11,13-heptaoxa-2,4,6,8,10,12,14-heptasilacyclotetradecane.
| Compound Name | 2,4,6,8,10,12,14-heptaethyl-1,3,5,7,9,11,13-heptaoxa-2,4,6,8,10,12,14-heptasilacyclotetradecane |
|---|---|
| PubChem CID | 547942 |
| Molecular Formula | C14H42O7Si7 |
| Molecular Weight | 519.09 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | 2,4,6,8,10,12,14-heptaethyl-1,3,5,7,9,11,13-heptaoxa-2,4,6,8,10,12,14-heptasilacyclotetradecane |
| SMILES | CC[SiH]1O[SiH](CC)O[SiH](CC)O[SiH](CC)O[SiH](CC)O[SiH](CC)O[SiH](CC)O1 |
| InChI | InChI=1S/C14H42O7Si7/c1-8-22-15-23(9-2)17-25(11-4)19-27(13-6)21-28(14-7)20-26(12-5)18-24(10-3)16-22/h22-28H,8-14H2,1-7H3 |
| InChIKey | UALFDNWOLXODHQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.09 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|