C16H26N2 — CID 54794486
N-[[1-(2-phenylethyl)piperidin-3-yl]methyl]ethanamine (PubChem CID 54794486) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is N-[[1-(2-phenylethyl)piperidin-3-yl]methyl]ethanamine.
| Compound Name | N-[[1-(2-phenylethyl)piperidin-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 54794486 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N-[[1-(2-phenylethyl)piperidin-3-yl]methyl]ethanamine |
| SMILES | CCNCC1CCCN(CCc2ccccc2)C1 |
| InChI | InChI=1S/C16H26N2/c1-2-17-13-16-9-6-11-18(14-16)12-10-15-7-4-3-5-8-15/h3-5,7-8,16-17H,2,6,9-14H2,1H3 |
| InChIKey | XJNIIMWEZXPAMD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |