C16H22O5 — CID 547948
1-(2-methoxyethoxymethoxy)-8-methyltetracyclo[6.3.0.02,4.03,7]undecane-5,10-dione (PubChem CID 547948) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1-(2-methoxyethoxymethoxy)-8-methyltetracyclo[6.3.0.02,4.03,7]undecane-5,10-dione.
| Compound Name | 1-(2-methoxyethoxymethoxy)-8-methyltetracyclo[6.3.0.02,4.03,7]undecane-5,10-dione |
|---|---|
| PubChem CID | 547948 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1-(2-methoxyethoxymethoxy)-8-methyltetracyclo[6.3.0.02,4.03,7]undecane-5,10-dione |
| SMILES | COCCOCOC12CC(=O)CC1(C)C1CC(=O)C3C1C32 |
| InChI | InChI=1S/C16H22O5/c1-15-6-9(17)7-16(15,21-8-20-4-3-19-2)14-12-10(15)5-11(18)13(12)14/h10,12-14H,3-8H2,1-2H3 |
| InChIKey | IELKLAWPIXZPMW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|