C17H28O3 — CID 54794877
(2,4-dipentoxyphenyl)methanol (PubChem CID 54794877) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is (2,4-dipentoxyphenyl)methanol.
| Compound Name | (2,4-dipentoxyphenyl)methanol |
|---|---|
| PubChem CID | 54794877 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (2,4-dipentoxyphenyl)methanol |
| SMILES | CCCCCOc1ccc(CO)c(OCCCCC)c1 |
| InChI | InChI=1S/C17H28O3/c1-3-5-7-11-19-16-10-9-15(14-18)17(13-16)20-12-8-6-4-2/h9-10,13,18H,3-8,11-12,14H2,1-2H3 |
| InChIKey | XPOMOULLUSHEMR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|