C49H32N4O8 — CID 5479496
4-[10,15,20-tris(4-carboxyphenyl)-23-methyl-21H-porphyrin-5-yl]benzoic acid (PubChem CID 5479496) has the molecular formula C49H32N4O8 and a molecular weight of 804.82 g/mol. Its IUPAC name is 4-[10,15,20-tris(4-carboxyphenyl)-23-methyl-21H-porphyrin-5-yl]benzoic acid.
| Compound Name | 4-[10,15,20-tris(4-carboxyphenyl)-23-methyl-21H-porphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 5479496 |
| Molecular Formula | C49H32N4O8 |
| Molecular Weight | 804.82 g/mol |
| Exact Mass | 804.22 |
| IUPAC Name | 4-[10,15,20-tris(4-carboxyphenyl)-23-methyl-21H-porphyrin-5-yl]benzoic acid |
| SMILES | Cn1c2ccc1c(-c1ccc(C(=O)O)cc1)c1nc(c(-c3ccc(C(=O)O)cc3)c3ccc([nH]3)c(-c3ccc(C(=O)O)cc3)c3nc(c2-c2ccc(C(=O)O)cc2)C=C3)C=C1 |
| InChI | InChI=1S/C49H32N4O8/c1-53-40-24-25-41(53)45(29-8-16-33(17-9-29)49(60)61)39-23-21-37(52-39)43(27-4-12-31(13-5-27)47(56)57)35-19-18-34(50-35)42(26-2-10-30(11-3-26)46(54)55)36-20-22-38(51-36)44(40)28-6-14-32(15-7-28)48(58)59/h2-25,50H,1H3,(H,54,55)(H,56,57)(H,58,59)(H,60,61)/b42-34-,42-36-,43-35-,43-37-,44-38-,44-40-,45-39-,45-41- |
| InChIKey | NOECUYRHWYWRBD-BQLHLCMASA-N |
| XLogP | 10.13 |
| TPSA | 195.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.82 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |