C18H21N3O3 — CID 54795721
3-[[2-(4-aminophenyl)acetyl]amino]-N-(2-methoxyethyl)benzamide (PubChem CID 54795721) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-[[2-(4-aminophenyl)acetyl]amino]-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[[2-(4-aminophenyl)acetyl]amino]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 54795721 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 3-[[2-(4-aminophenyl)acetyl]amino]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cccc(NC(=O)Cc2ccc(N)cc2)c1 |
| InChI | InChI=1S/C18H21N3O3/c1-24-10-9-20-18(23)14-3-2-4-16(12-14)21-17(22)11-13-5-7-15(19)8-6-13/h2-8,12H,9-11,19H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | KCJMCBOZIJJJTH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|