C23H34N2O — CID 54796277
1-N-[2-(2-butan-2-ylphenoxy)propyl]-4-N,4-N-diethylbenzene-1,4-diamine (PubChem CID 54796277) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is 1-N-[2-(2-butan-2-ylphenoxy)propyl]-4-N,4-N-diethylbenzene-1,4-diamine.
| Compound Name | 1-N-[2-(2-butan-2-ylphenoxy)propyl]-4-N,4-N-diethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 54796277 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | 1-N-[2-(2-butan-2-ylphenoxy)propyl]-4-N,4-N-diethylbenzene-1,4-diamine |
| SMILES | CCC(C)c1ccccc1OC(C)CNc1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C23H34N2O/c1-6-18(4)22-11-9-10-12-23(22)26-19(5)17-24-20-13-15-21(16-14-20)25(7-2)8-3/h9-16,18-19,24H,6-8,17H2,1-5H3 |
| InChIKey | UMPQMKAIOIJHGB-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|