C18H21Cl2NO — CID 54796892
3,5-dichloro-N-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]aniline (PubChem CID 54796892) has the molecular formula C18H21Cl2NO and a molecular weight of 338.28 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]aniline.
| Compound Name | 3,5-dichloro-N-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]aniline |
|---|---|
| PubChem CID | 54796892 |
| Molecular Formula | C18H21Cl2NO |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 3,5-dichloro-N-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]aniline |
| SMILES | Cc1ccc(C(C)C)c(OCCNc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C18H21Cl2NO/c1-12(2)17-5-4-13(3)8-18(17)22-7-6-21-16-10-14(19)9-15(20)11-16/h4-5,8-12,21H,6-7H2,1-3H3 |
| InChIKey | GFSHZBHPRLCPEP-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|