C27H32N8O6 — CID 5479930
2,4-bis[(Z)-C-methyl-N-(oxamoylamino)carbonimidoyl]-N,N'-bis(2-methylphenyl)pentanediamide (PubChem CID 5479930) has the molecular formula C27H32N8O6 and a molecular weight of 564.60 g/mol. Its IUPAC name is 2,4-bis[(Z)-C-methyl-N-(oxamoylamino)carbonimidoyl]-N,N'-bis(2-methylphenyl)pentanediamide.
| Compound Name | 2,4-bis[(Z)-C-methyl-N-(oxamoylamino)carbonimidoyl]-N,N'-bis(2-methylphenyl)pentanediamide |
|---|---|
| PubChem CID | 5479930 |
| Molecular Formula | C27H32N8O6 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 2,4-bis[(Z)-C-methyl-N-(oxamoylamino)carbonimidoyl]-N,N'-bis(2-methylphenyl)pentanediamide |
| SMILES | C/C(=N/NC(=O)C(N)=O)C(CC(C(=O)Nc1ccccc1C)/C(C)=N\NC(=O)C(N)=O)C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C27H32N8O6/c1-14-9-5-7-11-20(14)30-24(38)18(16(3)32-34-26(40)22(28)36)13-19(17(4)33-35-27(41)23(29)37)25(39)31-21-12-8-6-10-15(21)2/h5-12,18-19H,13H2,1-4H3,(H2,28,36)(H2,29,37)(H,30,38)(H,31,39)(H,34,40)(H,35,41)/b32-16-,33-17- |
| InChIKey | IINKYIHLRMWCIR-LLYQNFBTSA-N |
| XLogP | 0.46 |
| TPSA | 227.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|