C23H31NO3 — CID 54799558
N-[2-(2-tert-butylphenoxy)ethyl]-4-(oxolan-2-ylmethoxy)aniline (PubChem CID 54799558) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is N-[2-(2-tert-butylphenoxy)ethyl]-4-(oxolan-2-ylmethoxy)aniline.
| Compound Name | N-[2-(2-tert-butylphenoxy)ethyl]-4-(oxolan-2-ylmethoxy)aniline |
|---|---|
| PubChem CID | 54799558 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | N-[2-(2-tert-butylphenoxy)ethyl]-4-(oxolan-2-ylmethoxy)aniline |
| SMILES | CC(C)(C)c1ccccc1OCCNc1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C23H31NO3/c1-23(2,3)21-8-4-5-9-22(21)26-16-14-24-18-10-12-19(13-11-18)27-17-20-7-6-15-25-20/h4-5,8-13,20,24H,6-7,14-17H2,1-3H3 |
| InChIKey | XGRDPQSHQLYJQF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|