C24H20F2N6O2S — CID 5480221
2-(4-cyanophenyl)-N-[(2S,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 5480221) has the molecular formula C24H20F2N6O2S and a molecular weight of 494.53 g/mol. Its IUPAC name is 2-(4-cyanophenyl)-N-[(2S,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-cyanophenyl)-N-[(2S,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 5480221 |
| Molecular Formula | C24H20F2N6O2S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 2-(4-cyanophenyl)-N-[(2S,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccc(C#N)cc2)sc1C(=O)N[C@@H](C)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H20F2N6O2S/c1-14-21(35-23(30-14)17-5-3-16(10-27)4-6-17)22(33)31-15(2)24(34,11-32-13-28-12-29-32)19-8-7-18(25)9-20(19)26/h3-9,12-13,15,34H,11H2,1-2H3,(H,31,33)/t15-,24+/m0/s1 |
| InChIKey | YTGZINYACZKZEJ-IZHWHUGBSA-N |
| XLogP | 3.57 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |