C21H29NO — CID 54803695
1-[4-(3-methylbutoxy)phenyl]-N-[(2-methylphenyl)methyl]ethanamine (PubChem CID 54803695) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is 1-[4-(3-methylbutoxy)phenyl]-N-[(2-methylphenyl)methyl]ethanamine.
| Compound Name | 1-[4-(3-methylbutoxy)phenyl]-N-[(2-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 54803695 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 1-[4-(3-methylbutoxy)phenyl]-N-[(2-methylphenyl)methyl]ethanamine |
| SMILES | Cc1ccccc1CNC(C)c1ccc(OCCC(C)C)cc1 |
| InChI | InChI=1S/C21H29NO/c1-16(2)13-14-23-21-11-9-19(10-12-21)18(4)22-15-20-8-6-5-7-17(20)3/h5-12,16,18,22H,13-15H2,1-4H3 |
| InChIKey | NVAOFYWQOMLITN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |