About 4-cyclohexylbutanamide
4-cyclohexylbutanamide (PubChem CID 548040) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 4-cyclohexylbutanamide.
Molecular Properties
| Compound Name | 4-cyclohexylbutanamide |
| PubChem CID | 548040 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 4-cyclohexylbutanamide |
| SMILES | NC(=O)CCCC1CCCCC1 |
| InChI | InChI=1S/C10H19NO/c11-10(12)8-4-7-9-5-2-1-3-6-9/h9H,1-8H2,(H2,11,12) |
| InChIKey | HZGJWEZZXLGUAU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclohexylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylbutanamide?
The IUPAC name of 4-cyclohexylbutanamide (CID 548040) is 4-cyclohexylbutanamide.
What is the SMILES notation for 4-cyclohexylbutanamide?
The canonical SMILES for 4-cyclohexylbutanamide is NC(=O)CCCC1CCCCC1.
What is the InChIKey of 4-cyclohexylbutanamide?
The InChIKey is HZGJWEZZXLGUAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO/c11-10(12)8-4-7-9-5-2-1-3-6-9/h9H,1-8H2,(H2,11,12).
What are the key properties of 4-cyclohexylbutanamide?
4-cyclohexylbutanamide has a molecular weight of 169.27 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylbutanamide is sourced from PubChem (CID 548040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).