C18H23ClN2O — CID 54808219
N-[(2-chlorophenyl)methyl]-N'-(4-propoxyphenyl)ethane-1,2-diamine (PubChem CID 54808219) has the molecular formula C18H23ClN2O and a molecular weight of 318.85 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N'-(4-propoxyphenyl)ethane-1,2-diamine.
| Compound Name | N-[(2-chlorophenyl)methyl]-N'-(4-propoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54808219 |
| Molecular Formula | C18H23ClN2O |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N'-(4-propoxyphenyl)ethane-1,2-diamine |
| SMILES | CCCOc1ccc(NCCNCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C18H23ClN2O/c1-2-13-22-17-9-7-16(8-10-17)21-12-11-20-14-15-5-3-4-6-18(15)19/h3-10,20-21H,2,11-14H2,1H3 |
| InChIKey | YQSSXGJDUCWAMP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|