C25H27N3O2 — CID 54808952
N-benzyl-3-[[2-(N-ethylanilino)acetyl]amino]-N-methylbenzamide (PubChem CID 54808952) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-benzyl-3-[[2-(N-ethylanilino)acetyl]amino]-N-methylbenzamide.
| Compound Name | N-benzyl-3-[[2-(N-ethylanilino)acetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 54808952 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-benzyl-3-[[2-(N-ethylanilino)acetyl]amino]-N-methylbenzamide |
| SMILES | CCN(CC(=O)Nc1cccc(C(=O)N(C)Cc2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C25H27N3O2/c1-3-28(23-15-8-5-9-16-23)19-24(29)26-22-14-10-13-21(17-22)25(30)27(2)18-20-11-6-4-7-12-20/h4-17H,3,18-19H2,1-2H3,(H,26,29) |
| InChIKey | KMEPRRQRVHFEPO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |