C20H18ClN3O3 — CID 54809268
3-[[2-(3-chloroanilino)acetyl]amino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 54809268) has the molecular formula C20H18ClN3O3 and a molecular weight of 383.84 g/mol. Its IUPAC name is 3-[[2-(3-chloroanilino)acetyl]amino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-[[2-(3-chloroanilino)acetyl]amino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54809268 |
| Molecular Formula | C20H18ClN3O3 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 3-[[2-(3-chloroanilino)acetyl]amino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | O=C(CNc1cccc(Cl)c1)Nc1cccc(C(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C20H18ClN3O3/c21-15-5-2-6-16(11-15)22-13-19(25)24-17-7-1-4-14(10-17)20(26)23-12-18-8-3-9-27-18/h1-11,22H,12-13H2,(H,23,26)(H,24,25) |
| InChIKey | WWLVPHUVSLOQAD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |