About N'-(2,6-dimethylphenyl)-N-propylethane-1,2-diamine
N'-(2,6-dimethylphenyl)-N-propylethane-1,2-diamine (PubChem CID 54809643) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is N'-(2,6-dimethylphenyl)-N-propylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2,6-dimethylphenyl)-N-propylethane-1,2-diamine |
| PubChem CID | 54809643 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N'-(2,6-dimethylphenyl)-N-propylethane-1,2-diamine |
| SMILES | CCCNCCNc1c(C)cccc1C |
| InChI | InChI=1S/C13H22N2/c1-4-8-14-9-10-15-13-11(2)6-5-7-12(13)3/h5-7,14-15H,4,8-10H2,1-3H3 |
| InChIKey | LMTSDVBHRMAVTL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,6-dimethylphenyl)-N-propylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,6-dimethylphenyl)-N-propylethane-1,2-diamine?
The IUPAC name of N'-(2,6-dimethylphenyl)-N-propylethane-1,2-diamine (CID 54809643) is N'-(2,6-dimethylphenyl)-N-propylethane-1,2-diamine.
What is the SMILES notation for N'-(2,6-dimethylphenyl)-N-propylethane-1,2-diamine?
The canonical SMILES for N'-(2,6-dimethylphenyl)-N-propylethane-1,2-diamine is CCCNCCNc1c(C)cccc1C.
What is the InChIKey of N'-(2,6-dimethylphenyl)-N-propylethane-1,2-diamine?
The InChIKey is LMTSDVBHRMAVTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2/c1-4-8-14-9-10-15-13-11(2)6-5-7-12(13)3/h5-7,14-15H,4,8-10H2,1-3H3.
What are the key properties of N'-(2,6-dimethylphenyl)-N-propylethane-1,2-diamine?
N'-(2,6-dimethylphenyl)-N-propylethane-1,2-diamine has a molecular weight of 206.33 g/mol, XLogP of 2.71, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,6-dimethylphenyl)-N-propylethane-1,2-diamine is sourced from PubChem (CID 54809643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).